HOME | 로그인 | 회원가입 | 장바구니 | 문의하기
폐자원·바이오매스 종합정보 검색
일반자료 전문자료 전문가칼럼 최신연구동향 관련법규 공정시험법 용어사전 정보마당
일반자료
폐기물 개론
수집·운반
처리기술
소각기술
매립기술
사업장폐기물자원화
전문자료
음식물폐기물자원화
유기성오니자원화
기타 폐기물자원화
녹색마을 사업
일반도서
폐자원 및 에너지
아크로뱃리더 다운로드
16건의 자료가 검색되었습니다.
한글 전체 | | | | | | | | | | | | | | | 기타 |
영문 전체 | A | B | C | D | E | F | G | H | I | J | K | L | M | N | O | P | Q | R | S | T | U | V | W | X | Y | Z |
C/N비( C/N ratio)
CAF(Cavitation Air Flotation)
CDM(Clean Development Mechanism)
CEC(Caution exchange capacity)
Cell공법
CFCs(Chlorofluorocarbons)
Chicago Northwest 소각 시스템
CITES
CNG(Compressed Natural Gas)
Coase's Theory(코즈 정리)
COD(chemical oxygen demand, 화학적 산소요구량)
Cogeneration(열전병합 폐열발전)
COP6.5
CPI 방식(CPI method)
CVM(Contingent Valuation Method)
   1 . 2